C39H47N2O5S+ — CID 168782225
(2E)-2-[(E)-3-[1-[3-(4-hydroxyphenyl)propyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(6-oxoheptyl)indole-5-sulfonic acid (PubChem CID 168782225) has the molecular formula C39H47N2O5S+ and a molecular weight of 655.88 g/mol. Its IUPAC name is (2E)-2-[(E)-3-[1-[3-(4-hydroxyphenyl)propyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(6-oxoheptyl)indole-5-sulfonic acid.
| Compound Name | (2E)-2-[(E)-3-[1-[3-(4-hydroxyphenyl)propyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(6-oxoheptyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 168782225 |
| Molecular Formula | C39H47N2O5S+ |
| Molecular Weight | 655.88 g/mol |
| Exact Mass | 655.32 |
| IUPAC Name | (2E)-2-[(E)-3-[1-[3-(4-hydroxyphenyl)propyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(6-oxoheptyl)indole-5-sulfonic acid |
| SMILES | CC(=O)CCCCCN1/C(=C/C=C/C2=[N+](CCCc3ccc(O)cc3)c3ccccc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C39H46N2O5S/c1-28(42)13-7-6-10-25-40-35-24-23-31(47(44,45)46)27-33(35)39(4,5)37(40)18-11-17-36-38(2,3)32-15-8-9-16-34(32)41(36)26-12-14-29-19-21-30(43)22-20-29/h8-9,11,15-24,27H,6-7,10,12-14,25-26H2,1-5H3,(H-,43,44,45,46)/p+1 |
| InChIKey | WWAXNUVQJRPXAF-UHFFFAOYSA-O |
| XLogP | 8.04 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.88 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|