C42H53N2O6S+ — CID 171470533
(2E)-1-(7,7-dimethyl-6-oxooctyl)-2-[(E)-3-[1-[3-(4-hydroxyphenoxy)propyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid (PubChem CID 171470533) has the molecular formula C42H53N2O6S+ and a molecular weight of 713.96 g/mol. Its IUPAC name is (2E)-1-(7,7-dimethyl-6-oxooctyl)-2-[(E)-3-[1-[3-(4-hydroxyphenoxy)propyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | (2E)-1-(7,7-dimethyl-6-oxooctyl)-2-[(E)-3-[1-[3-(4-hydroxyphenoxy)propyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 171470533 |
| Molecular Formula | C42H53N2O6S+ |
| Molecular Weight | 713.96 g/mol |
| Exact Mass | 713.36 |
| IUPAC Name | (2E)-1-(7,7-dimethyl-6-oxooctyl)-2-[(E)-3-[1-[3-(4-hydroxyphenoxy)propyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid |
| SMILES | CC(C)(C)C(=O)CCCCCN1/C(=C/C=C/C2=[N+](CCCOc3ccc(O)cc3)c3ccccc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C42H52N2O6S/c1-40(2,3)39(46)19-9-8-12-26-43-36-25-24-32(51(47,48)49)29-34(36)42(6,7)38(43)18-13-17-37-41(4,5)33-15-10-11-16-35(33)44(37)27-14-28-50-31-22-20-30(45)21-23-31/h10-11,13,15-18,20-25,29H,8-9,12,14,19,26-28H2,1-7H3,(H-,45,47,48,49)/p+1 |
| InChIKey | PYYVIHRHCUTODM-UHFFFAOYSA-O |
| XLogP | 8.90 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.96 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|