C41H45N2O2+ — CID 59996521
2-[3-[3,3-dimethyl-1-(3-phenoxypropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenoxypropyl)indole (PubChem CID 59996521) has the molecular formula C41H45N2O2+ and a molecular weight of 597.82 g/mol. Its IUPAC name is 2-[3-[3,3-dimethyl-1-(3-phenoxypropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenoxypropyl)indole.
| Compound Name | 2-[3-[3,3-dimethyl-1-(3-phenoxypropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenoxypropyl)indole |
|---|---|
| PubChem CID | 59996521 |
| Molecular Formula | C41H45N2O2+ |
| Molecular Weight | 597.82 g/mol |
| Exact Mass | 597.35 |
| IUPAC Name | 2-[3-[3,3-dimethyl-1-(3-phenoxypropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenoxypropyl)indole |
| SMILES | CC1(C)C(=CC=CC2=[N+](CCCOc3ccccc3)c3ccccc3C2(C)C)N(CCCOc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C41H45N2O2/c1-40(2)34-22-11-13-24-36(34)42(28-16-30-44-32-18-7-5-8-19-32)38(40)26-15-27-39-41(3,4)35-23-12-14-25-37(35)43(39)29-17-31-45-33-20-9-6-10-21-33/h5-15,18-27H,16-17,28-31H2,1-4H3/q+1 |
| InChIKey | BPXPRDMHDNSHGS-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.82 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|