C30H39N2O+ — CID 142174987
3-[2-[(E,3E)-3-(1-butyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propan-1-ol (PubChem CID 142174987) has the molecular formula C30H39N2O+ and a molecular weight of 443.66 g/mol. Its IUPAC name is 3-[2-[(E,3E)-3-(1-butyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propan-1-ol.
| Compound Name | 3-[2-[(E,3E)-3-(1-butyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 142174987 |
| Molecular Formula | C30H39N2O+ |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | 3-[2-[(E,3E)-3-(1-butyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propan-1-ol |
| SMILES | CCCCN1/C(=C/C=C/C2=[N+](CCCO)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H39N2O/c1-6-7-20-31-25-16-10-8-14-23(25)29(2,3)27(31)18-12-19-28-30(4,5)24-15-9-11-17-26(24)32(28)21-13-22-33/h8-12,14-19,33H,6-7,13,20-22H2,1-5H3/q+1 |
| InChIKey | PGUCFKDLMRQKIQ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|