C34H45N2+ — CID 123469576
2-[5-(3,3-dimethyl-1-propylindol-1-ium-2-yl)penta-2,4-dienylidene]-1-hexyl-3,3-dimethylindole (PubChem CID 123469576) has the molecular formula C34H45N2+ and a molecular weight of 481.75 g/mol. Its IUPAC name is 2-[5-(3,3-dimethyl-1-propylindol-1-ium-2-yl)penta-2,4-dienylidene]-1-hexyl-3,3-dimethylindole.
| Compound Name | 2-[5-(3,3-dimethyl-1-propylindol-1-ium-2-yl)penta-2,4-dienylidene]-1-hexyl-3,3-dimethylindole |
|---|---|
| PubChem CID | 123469576 |
| Molecular Formula | C34H45N2+ |
| Molecular Weight | 481.75 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | 2-[5-(3,3-dimethyl-1-propylindol-1-ium-2-yl)penta-2,4-dienylidene]-1-hexyl-3,3-dimethylindole |
| SMILES | CCCCCCN1C(=CC=CC=CC2=[N+](CCC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C34H45N2/c1-7-9-10-18-26-36-30-22-17-15-20-28(30)34(5,6)32(36)24-13-11-12-23-31-33(3,4)27-19-14-16-21-29(27)35(31)25-8-2/h11-17,19-24H,7-10,18,25-26H2,1-6H3/q+1 |
| InChIKey | SMELXCUZDBGSAY-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.75 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|