C39H47N2+ — CID 153488960
1-benzyl-2-[(1E,3E,5E)-5-(1-heptyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium (PubChem CID 153488960) has the molecular formula C39H47N2+ and a molecular weight of 543.82 g/mol. Its IUPAC name is 1-benzyl-2-[(1E,3E,5E)-5-(1-heptyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium.
| Compound Name | 1-benzyl-2-[(1E,3E,5E)-5-(1-heptyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium |
|---|---|
| PubChem CID | 153488960 |
| Molecular Formula | C39H47N2+ |
| Molecular Weight | 543.82 g/mol |
| Exact Mass | 543.37 |
| IUPAC Name | 1-benzyl-2-[(1E,3E,5E)-5-(1-heptyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium |
| SMILES | CCCCCCCN1/C(=C/C=C/C=C/C2=[N+](Cc3ccccc3)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C39H47N2/c1-6-7-8-9-20-29-40-34-25-18-16-23-32(34)38(2,3)36(40)27-14-11-15-28-37-39(4,5)33-24-17-19-26-35(33)41(37)30-31-21-12-10-13-22-31/h10-19,21-28H,6-9,20,29-30H2,1-5H3/q+1 |
| InChIKey | JARHGECHVZIVOY-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.82 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|