C40H47BF4N2O2 — CID 46204578
ethyl 6-[(2E)-2-[(2E,4E)-5-(1-benzyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoate tetrafluoroborate (PubChem CID 46204578) has the molecular formula C40H47BF4N2O2 and a molecular weight of 674.63 g/mol. Its IUPAC name is ethyl 6-[(2E)-2-[(2E,4E)-5-(1-benzyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoate tetrafluoroborate.
| Compound Name | ethyl 6-[(2E)-2-[(2E,4E)-5-(1-benzyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoate tetrafluoroborate |
|---|---|
| PubChem CID | 46204578 |
| Molecular Formula | C40H47BF4N2O2 |
| Molecular Weight | 674.63 g/mol |
| Exact Mass | 674.37 |
| IUPAC Name | ethyl 6-[(2E)-2-[(2E,4E)-5-(1-benzyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoate tetrafluoroborate |
| SMILES | CCOC(=O)CCCCCN1/C(=C/C=C/C=C/C2=[N+](Cc3ccccc3)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.F[B-](F)(F)F |
| InChI | InChI=1S/C40H47N2O2.BF4/c1-6-44-38(43)28-14-9-19-29-41-34-24-17-15-22-32(34)39(2,3)36(41)26-12-8-13-27-37-40(4,5)33-23-16-18-25-35(33)42(37)30-31-20-10-7-11-21-31;2-1(3,4)5/h7-8,10-13,15-18,20-27H,6,9,14,19,28-30H2,1-5H3;/q+1;-1 |
| InChIKey | UTOCFPZLCJSGAY-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.63 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|