C32H41BrN2O2 — CID 112758622
6-[(2Z)-2-[(E)-3-(3,3-dimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]hexanoic acid bromide (PubChem CID 112758622) has the molecular formula C32H41BrN2O2 and a molecular weight of 565.60 g/mol. Its IUPAC name is 6-[(2Z)-2-[(E)-3-(3,3-dimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]hexanoic acid bromide.
| Compound Name | 6-[(2Z)-2-[(E)-3-(3,3-dimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]hexanoic acid bromide |
|---|---|
| PubChem CID | 112758622 |
| Molecular Formula | C32H41BrN2O2 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 6-[(2Z)-2-[(E)-3-(3,3-dimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]hexanoic acid bromide |
| SMILES | CCC[N+]1=C(/C=C/C=C2\N(CCCCCC(=O)O)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.[Br-] |
| InChI | InChI=1S/C32H40N2O2.BrH/c1-6-22-33-26-17-11-9-15-24(26)31(2,3)28(33)19-14-20-29-32(4,5)25-16-10-12-18-27(25)34(29)23-13-7-8-21-30(35)36;/h9-12,14-20H,6-8,13,21-23H2,1-5H3;1H |
| InChIKey | QOSVQAJVLAVVHL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|