C35H42N3O3+ — CID 11467016
1-[5-[(2E)-2-[(E)-3-(3,3-dimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]-2-oxopentyl]pyrrolidine-2,5-dione (PubChem CID 11467016) has the molecular formula C35H42N3O3+ and a molecular weight of 552.74 g/mol. Its IUPAC name is 1-[5-[(2E)-2-[(E)-3-(3,3-dimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]-2-oxopentyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[5-[(2E)-2-[(E)-3-(3,3-dimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]-2-oxopentyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11467016 |
| Molecular Formula | C35H42N3O3+ |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 1-[5-[(2E)-2-[(E)-3-(3,3-dimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]-2-oxopentyl]pyrrolidine-2,5-dione |
| SMILES | CCC[N+]1=C(/C=C/C=C2/N(CCCC(=O)CN3C(=O)CCC3=O)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C35H42N3O3/c1-6-22-36-28-16-9-7-14-26(28)34(2,3)30(36)18-11-19-31-35(4,5)27-15-8-10-17-29(27)37(31)23-12-13-25(39)24-38-32(40)20-21-33(38)41/h7-11,14-19H,6,12-13,20-24H2,1-5H3/q+1 |
| InChIKey | UZTSPOJEWWYDKA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 60.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|