C31H41ClN2O4 — CID 158174998
1-butyl-2-[3-(1-butyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole perchlorate (PubChem CID 158174998) has the molecular formula C31H41ClN2O4 and a molecular weight of 541.13 g/mol. Its IUPAC name is 1-butyl-2-[3-(1-butyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole perchlorate.
| Compound Name | 1-butyl-2-[3-(1-butyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole perchlorate |
|---|---|
| PubChem CID | 158174998 |
| Molecular Formula | C31H41ClN2O4 |
| Molecular Weight | 541.13 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 1-butyl-2-[3-(1-butyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole perchlorate |
| SMILES | CCCCN1C(=CC=CC2=[N+](CCCC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C31H41N2.ClHO4/c1-7-9-22-32-26-18-13-11-16-24(26)30(3,4)28(32)20-15-21-29-31(5,6)25-17-12-14-19-27(25)33(29)23-10-8-2;2-1(3,4)5/h11-21H,7-10,22-23H2,1-6H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | FXWZKFRLIOLSDQ-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|