C33H45ClN2O4 — CID 161154737
2-[3-[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-methylbutyl)indole perchlorate (PubChem CID 161154737) has the molecular formula C33H45ClN2O4 and a molecular weight of 569.19 g/mol. Its IUPAC name is 2-[3-[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-methylbutyl)indole perchlorate.
| Compound Name | 2-[3-[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-methylbutyl)indole perchlorate |
|---|---|
| PubChem CID | 161154737 |
| Molecular Formula | C33H45ClN2O4 |
| Molecular Weight | 569.19 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 2-[3-[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-methylbutyl)indole perchlorate |
| SMILES | CC(C)CCN1C(=CC=CC2=[N+](CCC(C)C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C33H45N2.ClHO4/c1-24(2)20-22-34-28-16-11-9-14-26(28)32(5,6)30(34)18-13-19-31-33(7,8)27-15-10-12-17-29(27)35(31)23-21-25(3)4;2-1(3,4)5/h9-19,24-25H,20-23H2,1-8H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | UPDMORGPFWJDRX-UHFFFAOYSA-M |
| XLogP | 3.64 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|