C31H37N2O4+ — CID 100988327
2-[2-[3-[1-(2-acetyloxyethyl)-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]ethyl acetate (PubChem CID 100988327) has the molecular formula C31H37N2O4+ and a molecular weight of 501.65 g/mol. Its IUPAC name is 2-[2-[3-[1-(2-acetyloxyethyl)-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]ethyl acetate.
| Compound Name | 2-[2-[3-[1-(2-acetyloxyethyl)-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 100988327 |
| Molecular Formula | C31H37N2O4+ |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 2-[2-[3-[1-(2-acetyloxyethyl)-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCN1C(=CC=CC2=[N+](CCOC(C)=O)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H37N2O4/c1-22(34)36-20-18-32-26-14-9-7-12-24(26)30(3,4)28(32)16-11-17-29-31(5,6)25-13-8-10-15-27(25)33(29)19-21-37-23(2)35/h7-17H,18-21H2,1-6H3/q+1 |
| InChIKey | DVQDXXWDZUIEGC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|