C31H35N2O4+ — CID 58265033
3-[2-[(1E,3E,5E)-5-[1-(2-formyloxyethyl)-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid (PubChem CID 58265033) has the molecular formula C31H35N2O4+ and a molecular weight of 499.63 g/mol. Its IUPAC name is 3-[2-[(1E,3E,5E)-5-[1-(2-formyloxyethyl)-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[2-[(1E,3E,5E)-5-[1-(2-formyloxyethyl)-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 58265033 |
| Molecular Formula | C31H35N2O4+ |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 3-[2-[(1E,3E,5E)-5-[1-(2-formyloxyethyl)-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCOC=O)c3ccccc3C2(C)C)=[N+](CCC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C31H34N2O4/c1-30(2)23-12-8-10-14-25(23)32(19-18-29(35)36)27(30)16-6-5-7-17-28-31(3,4)24-13-9-11-15-26(24)33(28)20-21-37-22-34/h5-17,22H,18-21H2,1-4H3/p+1 |
| InChIKey | WBGJALWYRIPEAI-UHFFFAOYSA-O |
| XLogP | 5.50 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|