C32H34N3O4+ — CID 76760298
3-[2-[3-cyano-5-[1-(2-formyloxyethyl)-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid (PubChem CID 76760298) has the molecular formula C32H34N3O4+ and a molecular weight of 524.64 g/mol. Its IUPAC name is 3-[2-[3-cyano-5-[1-(2-formyloxyethyl)-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[2-[3-cyano-5-[1-(2-formyloxyethyl)-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 76760298 |
| Molecular Formula | C32H34N3O4+ |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-[2-[3-cyano-5-[1-(2-formyloxyethyl)-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid |
| SMILES | CC1(C)C(=CC=C(C#N)C=CC2=[N+](CCC(=O)O)c3ccccc3C2(C)C)N(CCOC=O)c2ccccc21 |
| InChI | InChI=1S/C32H33N3O4/c1-31(2)24-9-5-7-11-26(24)34(18-17-30(37)38)28(31)15-13-23(21-33)14-16-29-32(3,4)25-10-6-8-12-27(25)35(29)19-20-39-22-36/h5-16,22H,17-20H2,1-4H3/p+1 |
| InChIKey | HSEDJJLSTCFTKN-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 93.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|