C34H36N3O4+ — CID 123419086
3-[2-[7-[1-(2-carboxyethyl)-3,3-dimethylindol-1-ium-2-yl]-7-cyanohepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propanoic acid (PubChem CID 123419086) has the molecular formula C34H36N3O4+ and a molecular weight of 550.68 g/mol. Its IUPAC name is 3-[2-[7-[1-(2-carboxyethyl)-3,3-dimethylindol-1-ium-2-yl]-7-cyanohepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propanoic acid.
| Compound Name | 3-[2-[7-[1-(2-carboxyethyl)-3,3-dimethylindol-1-ium-2-yl]-7-cyanohepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 123419086 |
| Molecular Formula | C34H36N3O4+ |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 3-[2-[7-[1-(2-carboxyethyl)-3,3-dimethylindol-1-ium-2-yl]-7-cyanohepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propanoic acid |
| SMILES | CC1(C)C(=CC=CC=CC=C(C#N)C2=[N+](CCC(=O)O)c3ccccc3C2(C)C)N(CCC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C34H35N3O4/c1-33(2)25-14-9-11-16-27(25)36(21-19-30(38)39)29(33)18-8-6-5-7-13-24(23-35)32-34(3,4)26-15-10-12-17-28(26)37(32)22-20-31(40)41/h5-18H,19-22H2,1-4H3,(H-,38,39,40,41)/p+1 |
| InChIKey | UPMGTPRDPSBLAH-UHFFFAOYSA-O |
| XLogP | 6.26 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|