C40H59N3O2+2 — CID 163520039
5-[(2E)-2-[(E)-3-[1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]pentyl-triethylazanium (PubChem CID 163520039) has the molecular formula C40H59N3O2+2 and a molecular weight of 613.93 g/mol. Its IUPAC name is 5-[(2E)-2-[(E)-3-[1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]pentyl-triethylazanium.
| Compound Name | 5-[(2E)-2-[(E)-3-[1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]pentyl-triethylazanium |
|---|---|
| PubChem CID | 163520039 |
| Molecular Formula | C40H59N3O2+2 |
| Molecular Weight | 613.93 g/mol |
| Exact Mass | 613.46 |
| IUPAC Name | 5-[(2E)-2-[(E)-3-[1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]pentyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCCCCN1/C(=C/C=C/C2=[N+](CCCCCC(=O)O)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C40H58N3O2/c1-8-43(9-2,10-3)31-20-12-19-30-42-35-25-17-15-23-33(35)40(6,7)37(42)27-21-26-36-39(4,5)32-22-14-16-24-34(32)41(36)29-18-11-13-28-38(44)45/h14-17,21-27H,8-13,18-20,28-31H2,1-7H3/q+1/p+1 |
| InChIKey | DJZWIRBJACNDGC-UHFFFAOYSA-O |
| XLogP | 8.99 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.93 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|