C35H52N4+2 — CID 59875158
3-[2-[(E,3E)-3-[1-(3-aminopropyl)-3,3-dimethylindol-2-ylidene]prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propyl-triethylazanium (PubChem CID 59875158) has the molecular formula C35H52N4+2 and a molecular weight of 528.83 g/mol. Its IUPAC name is 3-[2-[(E,3E)-3-[1-(3-aminopropyl)-3,3-dimethylindol-2-ylidene]prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propyl-triethylazanium.
| Compound Name | 3-[2-[(E,3E)-3-[1-(3-aminopropyl)-3,3-dimethylindol-2-ylidene]prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propyl-triethylazanium |
|---|---|
| PubChem CID | 59875158 |
| Molecular Formula | C35H52N4+2 |
| Molecular Weight | 528.83 g/mol |
| Exact Mass | 528.42 |
| IUPAC Name | 3-[2-[(E,3E)-3-[1-(3-aminopropyl)-3,3-dimethylindol-2-ylidene]prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCC[N+]1=C(/C=C/C=C2/N(CCCN)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C35H52N4/c1-8-39(9-2,10-3)27-17-26-38-31-21-14-12-19-29(31)35(6,7)33(38)23-15-22-32-34(4,5)28-18-11-13-20-30(28)37(32)25-16-24-36/h11-15,18-23H,8-10,16-17,24-27,36H2,1-7H3/q+2 |
| InChIKey | BQDNHSZTVDQIFY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.83 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|