C34H50N4+2 — CID 59875164
3-[(2E)-2-[(E)-3-[5-(aminomethyl)-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]propyl-triethylazanium (PubChem CID 59875164) has the molecular formula C34H50N4+2 and a molecular weight of 514.80 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-3-[5-(aminomethyl)-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]propyl-triethylazanium.
| Compound Name | 3-[(2E)-2-[(E)-3-[5-(aminomethyl)-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]propyl-triethylazanium |
|---|---|
| PubChem CID | 59875164 |
| Molecular Formula | C34H50N4+2 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.40 |
| IUPAC Name | 3-[(2E)-2-[(E)-3-[5-(aminomethyl)-1,3,3-trimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]propyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCCN1/C(=C/C=C/C2=[N+](C)c3ccc(CN)cc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C34H50N4/c1-9-38(10-2,11-3)23-15-22-37-30-17-13-12-16-27(30)33(4,5)32(37)19-14-18-31-34(6,7)28-24-26(25-35)20-21-29(28)36(31)8/h12-14,16-21,24H,9-11,15,22-23,25,35H2,1-8H3/q+2 |
| InChIKey | LXUMIPIVWSLDFB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|