C29H38N3+ — CID 138706340
4-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-methylbutan-1-amine (PubChem CID 138706340) has the molecular formula C29H38N3+ and a molecular weight of 428.64 g/mol. Its IUPAC name is 4-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-methylbutan-1-amine.
| Compound Name | 4-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 138706340 |
| Molecular Formula | C29H38N3+ |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 4-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-methylbutan-1-amine |
| SMILES | CNCCCCN1/C(=C/C=C/C2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C29H38N3/c1-28(2)22-14-7-9-16-24(22)31(6)26(28)18-13-19-27-29(3,4)23-15-8-10-17-25(23)32(27)21-12-11-20-30-5/h7-10,13-19,30H,11-12,20-21H2,1-6H3/q+1 |
| InChIKey | RTLAPPMESLUSFK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|