C44H65N4O+ — CID 159889762
6-[3,3-dimethyl-2-[5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-[3-(nonylamino)propyl]hexanamide (PubChem CID 159889762) has the molecular formula C44H65N4O+ and a molecular weight of 666.03 g/mol. Its IUPAC name is 6-[3,3-dimethyl-2-[5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-[3-(nonylamino)propyl]hexanamide.
| Compound Name | 6-[3,3-dimethyl-2-[5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-[3-(nonylamino)propyl]hexanamide |
|---|---|
| PubChem CID | 159889762 |
| Molecular Formula | C44H65N4O+ |
| Molecular Weight | 666.03 g/mol |
| Exact Mass | 665.52 |
| IUPAC Name | 6-[3,3-dimethyl-2-[5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-[3-(nonylamino)propyl]hexanamide |
| SMILES | CCCCCCCCCNCCCNC(=O)CCCCCN1C(=CC=CC=CC2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C44H64N4O/c1-7-8-9-10-11-12-22-32-45-33-24-34-46-42(49)31-17-14-23-35-48-39-28-21-19-26-37(39)44(4,5)41(48)30-16-13-15-29-40-43(2,3)36-25-18-20-27-38(36)47(40)6/h13,15-16,18-21,25-30,45H,7-12,14,17,22-24,31-35H2,1-6H3/p+1 |
| InChIKey | NUPDLRNTSXUPEA-UHFFFAOYSA-O |
| XLogP | 9.89 |
| TPSA | 47.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.03 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|