C37H50N3O3+ — CID 140897362
6-[(2E)-3,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-[2-(2-methoxyethoxy)ethyl]hexanamide (PubChem CID 140897362) has the molecular formula C37H50N3O3+ and a molecular weight of 584.82 g/mol. Its IUPAC name is 6-[(2E)-3,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-[2-(2-methoxyethoxy)ethyl]hexanamide.
| Compound Name | 6-[(2E)-3,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-[2-(2-methoxyethoxy)ethyl]hexanamide |
|---|---|
| PubChem CID | 140897362 |
| Molecular Formula | C37H50N3O3+ |
| Molecular Weight | 584.82 g/mol |
| Exact Mass | 584.38 |
| IUPAC Name | 6-[(2E)-3,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-[2-(2-methoxyethoxy)ethyl]hexanamide |
| SMILES | COCCOCCNC(=O)CCCCCN1/C(=C/C=C/C=C/C2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C37H49N3O3/c1-36(2)29-17-12-14-19-31(29)39(5)33(36)21-9-7-10-22-34-37(3,4)30-18-13-15-20-32(30)40(34)25-16-8-11-23-35(41)38-24-26-43-28-27-42-6/h7,9-10,12-15,17-22H,8,11,16,23-28H2,1-6H3/p+1 |
| InChIKey | ZGQXRCWVQNRYDF-UHFFFAOYSA-O |
| XLogP | 6.83 |
| TPSA | 53.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.82 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|