C35H46N3O2+ — CID 174076524
6-[3,3-dimethyl-2-[5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-(3-hydroxypropyl)hexanamide (PubChem CID 174076524) has the molecular formula C35H46N3O2+ and a molecular weight of 540.77 g/mol. Its IUPAC name is 6-[3,3-dimethyl-2-[5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-(3-hydroxypropyl)hexanamide.
| Compound Name | 6-[3,3-dimethyl-2-[5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-(3-hydroxypropyl)hexanamide |
|---|---|
| PubChem CID | 174076524 |
| Molecular Formula | C35H46N3O2+ |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.36 |
| IUPAC Name | 6-[3,3-dimethyl-2-[5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-1-yl]-N-(3-hydroxypropyl)hexanamide |
| SMILES | C[N+]1=C(C=CC=CC=C2N(CCCCCC(=O)NCCCO)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C35H45N3O2/c1-34(2)27-17-11-13-19-29(27)37(5)31(34)21-8-6-9-22-32-35(3,4)28-18-12-14-20-30(28)38(32)25-15-7-10-23-33(40)36-24-16-26-39/h6,8-9,11-14,17-22,39H,7,10,15-16,23-26H2,1-5H3/p+1 |
| InChIKey | AOVJYRNXYMPHRM-UHFFFAOYSA-O |
| XLogP | 6.55 |
| TPSA | 55.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|