C37H46N3O2+ — CID 176519688
6-[3,3-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-(4-oxohepta-5,6-dienyl)hexanamide (PubChem CID 176519688) has the molecular formula C37H46N3O2+ and a molecular weight of 564.79 g/mol. Its IUPAC name is 6-[3,3-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-(4-oxohepta-5,6-dienyl)hexanamide.
| Compound Name | 6-[3,3-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-(4-oxohepta-5,6-dienyl)hexanamide |
|---|---|
| PubChem CID | 176519688 |
| Molecular Formula | C37H46N3O2+ |
| Molecular Weight | 564.79 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | 6-[3,3-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-N-(4-oxohepta-5,6-dienyl)hexanamide |
| SMILES | C=C=CC(=O)CCCNC(=O)CCCCCN1C(=CC=CC2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C37H45N3O2/c1-7-17-28(41)18-16-26-38-35(42)25-9-8-14-27-40-32-22-13-11-20-30(32)37(4,5)34(40)24-15-23-33-36(2,3)29-19-10-12-21-31(29)39(33)6/h10-13,15,17,19-24H,1,8-9,14,16,18,25-27H2,2-6H3/p+1 |
| InChIKey | RDQYDYHHQNKKHI-UHFFFAOYSA-O |
| XLogP | 7.30 |
| TPSA | 52.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.79 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|