C33H43ClN6O — CID 134330209
N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(Z)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanamide chloride (PubChem CID 134330209) has the molecular formula C33H43ClN6O and a molecular weight of 575.20 g/mol. Its IUPAC name is N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(Z)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanamide chloride.
| Compound Name | N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(Z)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanamide chloride |
|---|---|
| PubChem CID | 134330209 |
| Molecular Formula | C33H43ClN6O |
| Molecular Weight | 575.20 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(Z)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanamide chloride |
| SMILES | C[N+]1=C(/C=C\C=C2\N(CCCCCC(=O)NCCCN=[N+]=[N-])c3ccccc3C2(C)C)C(C)(C)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C33H42N6O.ClH/c1-32(2)25-15-8-10-17-27(25)38(5)29(32)19-13-20-30-33(3,4)26-16-9-11-18-28(26)39(30)24-12-6-7-21-31(40)35-22-14-23-36-37-34;/h8-11,13,15-20H,6-7,12,14,21-24H2,1-5H3;1H |
| InChIKey | JWFYJJIXFMMPNH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|