C44H65N6O+ — CID 88529396
N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-[(2E)-3,3-dimethyl-2-[(2E,4E,6E)-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanamide (PubChem CID 88529396) has the molecular formula C44H65N6O+ and a molecular weight of 694.04 g/mol. Its IUPAC name is N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-[(2E)-3,3-dimethyl-2-[(2E,4E,6E)-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanamide.
| Compound Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-[(2E)-3,3-dimethyl-2-[(2E,4E,6E)-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanamide |
|---|---|
| PubChem CID | 88529396 |
| Molecular Formula | C44H65N6O+ |
| Molecular Weight | 694.04 g/mol |
| Exact Mass | 693.52 |
| IUPAC Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-[(2E)-3,3-dimethyl-2-[(2E,4E,6E)-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanamide |
| SMILES | C[N+]1=C(/C=C/C=C/C=C/C=C2/N(CCCCCC(=O)NCCCNCCCCNCCCN)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C44H64N6O/c1-43(2)36-22-13-15-24-38(36)49(5)40(43)26-10-7-6-8-11-27-41-44(3,4)37-23-14-16-25-39(37)50(41)35-19-9-12-28-42(51)48-34-21-33-47-31-18-17-30-46-32-20-29-45/h6-8,10-11,13-16,22-27,46-47H,9,12,17-21,28-35,45H2,1-5H3/p+1 |
| InChIKey | DDWWKBRHNONOER-UHFFFAOYSA-O |
| XLogP | 7.42 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.04 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|