C37H47N6O+ — CID 135563607
N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(2E,4E,6E)-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanamide (PubChem CID 135563607) has the molecular formula C37H47N6O+ and a molecular weight of 591.82 g/mol. Its IUPAC name is N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(2E,4E,6E)-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanamide.
| Compound Name | N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(2E,4E,6E)-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanamide |
|---|---|
| PubChem CID | 135563607 |
| Molecular Formula | C37H47N6O+ |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.38 |
| IUPAC Name | N-(3-azidopropyl)-6-[(2E)-3,3-dimethyl-2-[(2E,4E,6E)-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indol-1-yl]hexanamide |
| SMILES | C[N+]1=C(/C=C/C=C/C=C/C=C2/N(CCCCCC(=O)NCCCN=[N+]=[N-])c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C37H46N6O/c1-36(2)29-19-13-15-21-31(29)42(5)33(36)23-10-7-6-8-11-24-34-37(3,4)30-20-14-16-22-32(30)43(34)28-17-9-12-25-35(44)39-26-18-27-40-41-38/h6-8,10-11,13-16,19-24H,9,12,17-18,25-28H2,1-5H3/p+1 |
| InChIKey | FZFBQHZYUUQWGP-UHFFFAOYSA-O |
| XLogP | 8.42 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|