C31H40N5O+ — CID 123276364
1-[6-(azidomethoxy)hexyl]-3,3-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole (PubChem CID 123276364) has the molecular formula C31H40N5O+ and a molecular weight of 498.70 g/mol. Its IUPAC name is 1-[6-(azidomethoxy)hexyl]-3,3-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole.
| Compound Name | 1-[6-(azidomethoxy)hexyl]-3,3-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
|---|---|
| PubChem CID | 123276364 |
| Molecular Formula | C31H40N5O+ |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 1-[6-(azidomethoxy)hexyl]-3,3-dimethyl-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
| SMILES | C[N+]1=C(C=CC=C2N(CCCCCCOCN=[N+]=[N-])c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H40N5O/c1-30(2)24-15-8-10-17-26(24)35(5)28(30)19-14-20-29-31(3,4)25-16-9-11-18-27(25)36(29)21-12-6-7-13-22-37-23-33-34-32/h8-11,14-20H,6-7,12-13,21-23H2,1-5H3/q+1 |
| InChIKey | CICMPPLDPZBJPP-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 64.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|