C34H45N2O+ — CID 166713038
9-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-2-methylnonan-3-one (PubChem CID 166713038) has the molecular formula C34H45N2O+ and a molecular weight of 497.75 g/mol. Its IUPAC name is 9-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-2-methylnonan-3-one.
| Compound Name | 9-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-2-methylnonan-3-one |
|---|---|
| PubChem CID | 166713038 |
| Molecular Formula | C34H45N2O+ |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | 9-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]-2-methylnonan-3-one |
| SMILES | CC(C)C(=O)CCCCCCN1/C(=C/C=C/C2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C34H45N2O/c1-25(2)30(37)21-10-8-9-15-24-36-29-20-14-12-18-27(29)34(5,6)32(36)23-16-22-31-33(3,4)26-17-11-13-19-28(26)35(31)7/h11-14,16-20,22-23,25H,8-10,15,21,24H2,1-7H3/q+1 |
| InChIKey | ONORCDCFQIFJGU-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|