C34H43N2+ — CID 123598650
1-butyl-3,3,5-trimethyl-2-[7-(1,3,3,5-tetramethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole (PubChem CID 123598650) has the molecular formula C34H43N2+ and a molecular weight of 479.73 g/mol. Its IUPAC name is 1-butyl-3,3,5-trimethyl-2-[7-(1,3,3,5-tetramethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole.
| Compound Name | 1-butyl-3,3,5-trimethyl-2-[7-(1,3,3,5-tetramethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole |
|---|---|
| PubChem CID | 123598650 |
| Molecular Formula | C34H43N2+ |
| Molecular Weight | 479.73 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | 1-butyl-3,3,5-trimethyl-2-[7-(1,3,3,5-tetramethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole |
| SMILES | CCCCN1C(=CC=CC=CC=CC2=[N+](C)c3ccc(C)cc3C2(C)C)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C34H43N2/c1-9-10-22-36-30-21-19-26(3)24-28(30)34(6,7)32(36)17-15-13-11-12-14-16-31-33(4,5)27-23-25(2)18-20-29(27)35(31)8/h11-21,23-24H,9-10,22H2,1-8H3/q+1 |
| InChIKey | VALWNGBLNQVIFO-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.73 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|