C46H50BrN2+ — CID 122534553
(2E)-2-[(2E,4E,6E)-7-[5-bromo-3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethyl-1-(3-phenylpropyl)indole (PubChem CID 122534553) has the molecular formula C46H50BrN2+ and a molecular weight of 710.82 g/mol. Its IUPAC name is (2E)-2-[(2E,4E,6E)-7-[5-bromo-3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethyl-1-(3-phenylpropyl)indole.
| Compound Name | (2E)-2-[(2E,4E,6E)-7-[5-bromo-3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethyl-1-(3-phenylpropyl)indole |
|---|---|
| PubChem CID | 122534553 |
| Molecular Formula | C46H50BrN2+ |
| Molecular Weight | 710.82 g/mol |
| Exact Mass | 709.32 |
| IUPAC Name | (2E)-2-[(2E,4E,6E)-7-[5-bromo-3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethyl-1-(3-phenylpropyl)indole |
| SMILES | Cc1ccc2c(c1)C(C)(C)/C(=C\C=C\C=C\C=C\C1=[N+](CCCc3ccccc3)c3ccc(Br)cc3C1(C)C)N2CCCc1ccccc1 |
| InChI | InChI=1S/C46H50BrN2/c1-35-27-29-41-39(33-35)45(2,3)43(48(41)31-17-23-36-19-11-9-12-20-36)25-15-7-6-8-16-26-44-46(4,5)40-34-38(47)28-30-42(40)49(44)32-18-24-37-21-13-10-14-22-37/h6-16,19-22,25-30,33-34H,17-18,23-24,31-32H2,1-5H3/q+1 |
| InChIKey | HTNJSMOJMAGEFG-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.82 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|