C38H41Br2N — CID 122536750
(2E)-5-bromo-2-[(2E,4E,6E)-9-(5-bromo-2-methylphenyl)-9-methyl-8-methylidenedeca-2,4,6-trienylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole (PubChem CID 122536750) has the molecular formula C38H41Br2N and a molecular weight of 671.56 g/mol. Its IUPAC name is (2E)-5-bromo-2-[(2E,4E,6E)-9-(5-bromo-2-methylphenyl)-9-methyl-8-methylidenedeca-2,4,6-trienylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole.
| Compound Name | (2E)-5-bromo-2-[(2E,4E,6E)-9-(5-bromo-2-methylphenyl)-9-methyl-8-methylidenedeca-2,4,6-trienylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole |
|---|---|
| PubChem CID | 122536750 |
| Molecular Formula | C38H41Br2N |
| Molecular Weight | 671.56 g/mol |
| Exact Mass | 669.16 |
| IUPAC Name | (2E)-5-bromo-2-[(2E,4E,6E)-9-(5-bromo-2-methylphenyl)-9-methyl-8-methylidenedeca-2,4,6-trienylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole |
| SMILES | C=C(/C=C/C=C/C=C/C=C1/N(CCCc2ccccc2)c2ccc(Br)cc2C1(C)C)C(C)(C)c1cc(Br)ccc1C |
| InChI | InChI=1S/C38H41Br2N/c1-28-21-22-31(39)26-33(28)37(3,4)29(2)16-11-8-7-9-14-20-36-38(5,6)34-27-32(40)23-24-35(34)41(36)25-15-19-30-17-12-10-13-18-30/h7-14,16-18,20-24,26-27H,2,15,19,25H2,1,3-6H3/b8-7+,14-9+,16-11+,36-20+ |
| InChIKey | GRLYUUIQGLOSJJ-ANDUUNKOSA-N |
| XLogP | 11.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.56 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|