C40H47NO8S2 — CID 122536790
3-[4-[(1E,2Z,4E)-1-(1-butyl-3,3-dimethyl-5-sulfoindol-2-ylidene)-7-methyl-6-methylidene-7-(2-methyl-5-sulfophenyl)octa-2,4-dien-3-yl]phenyl]propanoic acid (PubChem CID 122536790) has the molecular formula C40H47NO8S2 and a molecular weight of 733.95 g/mol. Its IUPAC name is 3-[4-[(1E,2Z,4E)-1-(1-butyl-3,3-dimethyl-5-sulfoindol-2-ylidene)-7-methyl-6-methylidene-7-(2-methyl-5-sulfophenyl)octa-2,4-dien-3-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[(1E,2Z,4E)-1-(1-butyl-3,3-dimethyl-5-sulfoindol-2-ylidene)-7-methyl-6-methylidene-7-(2-methyl-5-sulfophenyl)octa-2,4-dien-3-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122536790 |
| Molecular Formula | C40H47NO8S2 |
| Molecular Weight | 733.95 g/mol |
| Exact Mass | 733.27 |
| IUPAC Name | 3-[4-[(1E,2Z,4E)-1-(1-butyl-3,3-dimethyl-5-sulfoindol-2-ylidene)-7-methyl-6-methylidene-7-(2-methyl-5-sulfophenyl)octa-2,4-dien-3-yl]phenyl]propanoic acid |
| SMILES | C=C(/C=C/C(=C/C=C1/N(CCCC)c2ccc(S(=O)(=O)O)cc2C1(C)C)c1ccc(CCC(=O)O)cc1)C(C)(C)c1cc(S(=O)(=O)O)ccc1C |
| InChI | InChI=1S/C40H47NO8S2/c1-8-9-24-41-36-21-20-33(51(47,48)49)26-35(36)40(6,7)37(41)22-18-30(31-16-12-29(13-17-31)14-23-38(42)43)15-11-28(3)39(4,5)34-25-32(50(44,45)46)19-10-27(34)2/h10-13,15-22,25-26H,3,8-9,14,23-24H2,1-2,4-7H3,(H,42,43)(H,44,45,46)(H,47,48,49)/b15-11+,30-18-,37-22+ |
| InChIKey | ORDLTALJHVIRRZ-VHMKXFNZSA-N |
| XLogP | 8.46 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.95 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|