C38H48N3O6S2+ — CID 122536751
3-[(2E)-3,3-dimethyl-2-[(2Z,4E)-7-methyl-6-methylidene-7-(2-methyl-5-sulfophenyl)-3-pyridin-4-ylocta-2,4-dienylidene]-5-sulfoindol-1-yl]propyl-trimethylazanium (PubChem CID 122536751) has the molecular formula C38H48N3O6S2+ and a molecular weight of 706.95 g/mol. Its IUPAC name is 3-[(2E)-3,3-dimethyl-2-[(2Z,4E)-7-methyl-6-methylidene-7-(2-methyl-5-sulfophenyl)-3-pyridin-4-ylocta-2,4-dienylidene]-5-sulfoindol-1-yl]propyl-trimethylazanium.
| Compound Name | 3-[(2E)-3,3-dimethyl-2-[(2Z,4E)-7-methyl-6-methylidene-7-(2-methyl-5-sulfophenyl)-3-pyridin-4-ylocta-2,4-dienylidene]-5-sulfoindol-1-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 122536751 |
| Molecular Formula | C38H48N3O6S2+ |
| Molecular Weight | 706.95 g/mol |
| Exact Mass | 706.30 |
| IUPAC Name | 3-[(2E)-3,3-dimethyl-2-[(2Z,4E)-7-methyl-6-methylidene-7-(2-methyl-5-sulfophenyl)-3-pyridin-4-ylocta-2,4-dienylidene]-5-sulfoindol-1-yl]propyl-trimethylazanium |
| SMILES | C=C(/C=C/C(=C/C=C1/N(CCC[N+](C)(C)C)c2ccc(S(=O)(=O)O)cc2C1(C)C)c1ccncc1)C(C)(C)c1cc(S(=O)(=O)O)ccc1C |
| InChI | InChI=1S/C38H47N3O6S2/c1-27-11-15-31(48(42,43)44)25-33(27)37(3,4)28(2)12-13-29(30-19-21-39-22-20-30)14-18-36-38(5,6)34-26-32(49(45,46)47)16-17-35(34)40(36)23-10-24-41(7,8)9/h11-22,25-26H,2,10,23-24H2,1,3-9H3,(H-,42,43,44,45,46,47)/p+1/b13-12+,29-14-,36-18+ |
| InChIKey | UOFWHAMHQALQNH-GBRUDTKXSA-O |
| XLogP | 7.14 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.95 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|