C29H37NO3S — CID 122536716
(2E)-1-butyl-3,3-dimethyl-2-[(E)-5-methyl-4-methylidene-5-(2-methylphenyl)hex-2-enylidene]indole-5-sulfonic acid (PubChem CID 122536716) has the molecular formula C29H37NO3S and a molecular weight of 479.69 g/mol. Its IUPAC name is (2E)-1-butyl-3,3-dimethyl-2-[(E)-5-methyl-4-methylidene-5-(2-methylphenyl)hex-2-enylidene]indole-5-sulfonic acid.
| Compound Name | (2E)-1-butyl-3,3-dimethyl-2-[(E)-5-methyl-4-methylidene-5-(2-methylphenyl)hex-2-enylidene]indole-5-sulfonic acid |
|---|---|
| PubChem CID | 122536716 |
| Molecular Formula | C29H37NO3S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (2E)-1-butyl-3,3-dimethyl-2-[(E)-5-methyl-4-methylidene-5-(2-methylphenyl)hex-2-enylidene]indole-5-sulfonic acid |
| SMILES | C=C(/C=C/C=C1/N(CCCC)c2ccc(S(=O)(=O)O)cc2C1(C)C)C(C)(C)c1ccccc1C |
| InChI | InChI=1S/C29H37NO3S/c1-8-9-19-30-26-18-17-23(34(31,32)33)20-25(26)29(6,7)27(30)16-12-14-22(3)28(4,5)24-15-11-10-13-21(24)2/h10-18,20H,3,8-9,19H2,1-2,4-7H3,(H,31,32,33)/b14-12+,27-16+ |
| InChIKey | RBWCGRWVFPQRPZ-ATOXWBSZSA-N |
| XLogP | 7.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|