C41H45N — CID 122536701
(2E)-3-butyl-1,1-dimethyl-2-[(2E,4E,6E)-9-methyl-8-methylidene-9-(2-methylnaphthalen-1-yl)deca-2,4,6-trienylidene]benzo[e]indole (PubChem CID 122536701) has the molecular formula C41H45N and a molecular weight of 551.82 g/mol. Its IUPAC name is (2E)-3-butyl-1,1-dimethyl-2-[(2E,4E,6E)-9-methyl-8-methylidene-9-(2-methylnaphthalen-1-yl)deca-2,4,6-trienylidene]benzo[e]indole.
| Compound Name | (2E)-3-butyl-1,1-dimethyl-2-[(2E,4E,6E)-9-methyl-8-methylidene-9-(2-methylnaphthalen-1-yl)deca-2,4,6-trienylidene]benzo[e]indole |
|---|---|
| PubChem CID | 122536701 |
| Molecular Formula | C41H45N |
| Molecular Weight | 551.82 g/mol |
| Exact Mass | 551.36 |
| IUPAC Name | (2E)-3-butyl-1,1-dimethyl-2-[(2E,4E,6E)-9-methyl-8-methylidene-9-(2-methylnaphthalen-1-yl)deca-2,4,6-trienylidene]benzo[e]indole |
| SMILES | C=C(/C=C/C=C/C=C/C=C1/N(CCCC)c2ccc3ccccc3c2C1(C)C)C(C)(C)c1c(C)ccc2ccccc12 |
| InChI | InChI=1S/C41H45N/c1-8-9-29-42-36-28-27-33-21-16-18-23-35(33)39(36)41(6,7)37(42)24-14-12-10-11-13-19-31(3)40(4,5)38-30(2)25-26-32-20-15-17-22-34(32)38/h10-28H,3,8-9,29H2,1-2,4-7H3/b11-10+,14-12+,19-13+,37-24+ |
| InChIKey | FEPKJOPWJFHMMQ-XUNBVSFQSA-N |
| XLogP | 11.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.82 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|