C40H43N2O2+ — CID 145242613
2-carboxyethyl-[1-[(4E,6E,8E,10E)-2-methyl-3-methylidene-10-(1,1,3-trimethylbenzo[e]indol-2-ylidene)deca-4,6,8-trien-2-yl]naphthalen-2-yl]azanium (PubChem CID 145242613) has the molecular formula C40H43N2O2+ and a molecular weight of 583.80 g/mol. Its IUPAC name is 2-carboxyethyl-[1-[(4E,6E,8E,10E)-2-methyl-3-methylidene-10-(1,1,3-trimethylbenzo[e]indol-2-ylidene)deca-4,6,8-trien-2-yl]naphthalen-2-yl]azanium.
| Compound Name | 2-carboxyethyl-[1-[(4E,6E,8E,10E)-2-methyl-3-methylidene-10-(1,1,3-trimethylbenzo[e]indol-2-ylidene)deca-4,6,8-trien-2-yl]naphthalen-2-yl]azanium |
|---|---|
| PubChem CID | 145242613 |
| Molecular Formula | C40H43N2O2+ |
| Molecular Weight | 583.80 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | 2-carboxyethyl-[1-[(4E,6E,8E,10E)-2-methyl-3-methylidene-10-(1,1,3-trimethylbenzo[e]indol-2-ylidene)deca-4,6,8-trien-2-yl]naphthalen-2-yl]azanium |
| SMILES | C=C(/C=C/C=C/C=C/C=C1/N(C)c2ccc3ccccc3c2C1(C)C)C(C)(C)c1c([NH2+]CCC(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C40H42N2O2/c1-28(39(2,3)37-31-19-14-12-17-29(31)22-24-33(37)41-27-26-36(43)44)16-10-8-7-9-11-21-35-40(4,5)38-32-20-15-13-18-30(32)23-25-34(38)42(35)6/h7-25,41H,1,26-27H2,2-6H3,(H,43,44)/p+1/b8-7+,11-9+,16-10+,35-21+ |
| InChIKey | OLNKZTHKBJCXLT-CIWIGDEYSA-O |
| XLogP | 8.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.80 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|