C34H32N2 — CID 90455495
(2E)-2-[(2E,4E)-5-(1,1-dimethylbenzo[e]indol-2-yl)penta-2,4-dienylidene]-1,1,3-trimethylbenzo[e]indole (PubChem CID 90455495) has the molecular formula C34H32N2 and a molecular weight of 468.64 g/mol. Its IUPAC name is (2E)-2-[(2E,4E)-5-(1,1-dimethylbenzo[e]indol-2-yl)penta-2,4-dienylidene]-1,1,3-trimethylbenzo[e]indole.
| Compound Name | (2E)-2-[(2E,4E)-5-(1,1-dimethylbenzo[e]indol-2-yl)penta-2,4-dienylidene]-1,1,3-trimethylbenzo[e]indole |
|---|---|
| PubChem CID | 90455495 |
| Molecular Formula | C34H32N2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | (2E)-2-[(2E,4E)-5-(1,1-dimethylbenzo[e]indol-2-yl)penta-2,4-dienylidene]-1,1,3-trimethylbenzo[e]indole |
| SMILES | CN1/C(=C/C=C/C=C/C2=Nc3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C34H32N2/c1-33(2)29(35-27-21-19-23-13-9-11-15-25(23)31(27)33)17-7-6-8-18-30-34(3,4)32-26-16-12-10-14-24(26)20-22-28(32)36(30)5/h6-22H,1-5H3/b8-6+,17-7+,30-18+ |
| InChIKey | NGXKIYNQKLGKCI-IZFUJLBPSA-N |
| XLogP | 8.78 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|