C40H38N3+ — CID 58434221
(2Z,4E,6E)-2-[(1E,3E)-4-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-6-(1,1,3-trimethylbenzo[e]indol-2-ylidene)hexa-2,4-dienenitrile (PubChem CID 58434221) has the molecular formula C40H38N3+ and a molecular weight of 560.77 g/mol. Its IUPAC name is (2Z,4E,6E)-2-[(1E,3E)-4-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-6-(1,1,3-trimethylbenzo[e]indol-2-ylidene)hexa-2,4-dienenitrile.
| Compound Name | (2Z,4E,6E)-2-[(1E,3E)-4-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-6-(1,1,3-trimethylbenzo[e]indol-2-ylidene)hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 58434221 |
| Molecular Formula | C40H38N3+ |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (2Z,4E,6E)-2-[(1E,3E)-4-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-6-(1,1,3-trimethylbenzo[e]indol-2-ylidene)hexa-2,4-dienenitrile |
| SMILES | CN1/C(=C/C=C/C=C(C#N)/C=C/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C40H38N3/c1-39(2)35(42(5)33-25-23-29-17-9-11-19-31(29)37(33)39)21-13-7-15-28(27-41)16-8-14-22-36-40(3,4)38-32-20-12-10-18-30(32)24-26-34(38)43(36)6/h7-26H,1-6H3/q+1 |
| InChIKey | PTJZFOWGZFLMOC-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 30.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|