C39H37N2+ — CID 59172023
1-benzyl-1,3-dimethyl-2-[3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole (PubChem CID 59172023) has the molecular formula C39H37N2+ and a molecular weight of 533.74 g/mol. Its IUPAC name is 1-benzyl-1,3-dimethyl-2-[3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole.
| Compound Name | 1-benzyl-1,3-dimethyl-2-[3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole |
|---|---|
| PubChem CID | 59172023 |
| Molecular Formula | C39H37N2+ |
| Molecular Weight | 533.74 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | 1-benzyl-1,3-dimethyl-2-[3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole |
| SMILES | CN1C(=CC=CC2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(Cc2ccccc2)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C39H37N2/c1-38(2)34(40(4)32-24-22-28-16-9-11-18-30(28)36(32)38)20-13-21-35-39(3,26-27-14-7-6-8-15-27)37-31-19-12-10-17-29(31)23-25-33(37)41(35)5/h6-25H,26H2,1-5H3/q+1 |
| InChIKey | OPISYGDIMUEZFI-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.74 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|