C48H45N2+ — CID 89142585
1-benzyl-2-[(E,3E)-3-(3,3-dibenzyl-1,5-dimethylindol-2-ylidene)prop-1-enyl]-1,3-dimethylbenzo[e]indol-3-ium (PubChem CID 89142585) has the molecular formula C48H45N2+ and a molecular weight of 649.90 g/mol. Its IUPAC name is 1-benzyl-2-[(E,3E)-3-(3,3-dibenzyl-1,5-dimethylindol-2-ylidene)prop-1-enyl]-1,3-dimethylbenzo[e]indol-3-ium.
| Compound Name | 1-benzyl-2-[(E,3E)-3-(3,3-dibenzyl-1,5-dimethylindol-2-ylidene)prop-1-enyl]-1,3-dimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 89142585 |
| Molecular Formula | C48H45N2+ |
| Molecular Weight | 649.90 g/mol |
| Exact Mass | 649.36 |
| IUPAC Name | 1-benzyl-2-[(E,3E)-3-(3,3-dibenzyl-1,5-dimethylindol-2-ylidene)prop-1-enyl]-1,3-dimethylbenzo[e]indol-3-ium |
| SMILES | Cc1ccc2c(c1)C(Cc1ccccc1)(Cc1ccccc1)/C(=C\C=C\C1=[N+](C)c3ccc4ccccc4c3C1(C)Cc1ccccc1)N2C |
| InChI | InChI=1S/C48H45N2/c1-35-27-29-42-41(31-35)48(33-37-19-10-6-11-20-37,34-38-21-12-7-13-22-38)45(49(42)3)26-16-25-44-47(2,32-36-17-8-5-9-18-36)46-40-24-15-14-23-39(40)28-30-43(46)50(44)4/h5-31H,32-34H2,1-4H3/q+1 |
| InChIKey | NBYOSYKFNBPJCK-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.90 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|