C44H43N2+ — CID 91506104
1,1-dibenzyl-3-methyl-2-[3-(1,3,5-trimethyl-3-prop-2-enylindol-2-ylidene)prop-1-enyl]benzo[e]indol-3-ium (PubChem CID 91506104) has the molecular formula C44H43N2+ and a molecular weight of 599.84 g/mol. Its IUPAC name is 1,1-dibenzyl-3-methyl-2-[3-(1,3,5-trimethyl-3-prop-2-enylindol-2-ylidene)prop-1-enyl]benzo[e]indol-3-ium.
| Compound Name | 1,1-dibenzyl-3-methyl-2-[3-(1,3,5-trimethyl-3-prop-2-enylindol-2-ylidene)prop-1-enyl]benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 91506104 |
| Molecular Formula | C44H43N2+ |
| Molecular Weight | 599.84 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | 1,1-dibenzyl-3-methyl-2-[3-(1,3,5-trimethyl-3-prop-2-enylindol-2-ylidene)prop-1-enyl]benzo[e]indol-3-ium |
| SMILES | C=CCC1(C)C(=CC=CC2=[N+](C)c3ccc4ccccc4c3C2(Cc2ccccc2)Cc2ccccc2)N(C)c2ccc(C)cc21 |
| InChI | InChI=1S/C44H43N2/c1-6-28-43(3)37-29-32(2)24-26-38(37)45(4)40(43)22-15-23-41-44(30-33-16-9-7-10-17-33,31-34-18-11-8-12-19-34)42-36-21-14-13-20-35(36)25-27-39(42)46(41)5/h6-27,29H,1,28,30-31H2,2-5H3/q+1 |
| InChIKey | WJZJGZAJUULRTE-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.84 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|