C38H41N2+ — CID 91230901
1-benzyl-1,3-dimethyl-2-[3-(3,3,5-trimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]benzo[e]indole (PubChem CID 91230901) has the molecular formula C38H41N2+ and a molecular weight of 525.76 g/mol. Its IUPAC name is 1-benzyl-1,3-dimethyl-2-[3-(3,3,5-trimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]benzo[e]indole.
| Compound Name | 1-benzyl-1,3-dimethyl-2-[3-(3,3,5-trimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]benzo[e]indole |
|---|---|
| PubChem CID | 91230901 |
| Molecular Formula | C38H41N2+ |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.33 |
| IUPAC Name | 1-benzyl-1,3-dimethyl-2-[3-(3,3,5-trimethyl-1-propylindol-1-ium-2-yl)prop-2-enylidene]benzo[e]indole |
| SMILES | CCC[N+]1=C(C=CC=C2N(C)c3ccc4ccccc4c3C2(C)Cc2ccccc2)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C38H41N2/c1-7-24-40-32-22-20-27(2)25-31(32)37(3,4)34(40)18-13-19-35-38(5,26-28-14-9-8-10-15-28)36-30-17-12-11-16-29(30)21-23-33(36)39(35)6/h8-23,25H,7,24,26H2,1-6H3/q+1 |
| InChIKey | JKVNMWKTUSWDMJ-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|