C37H39N2+ — CID 59307304
2-[(E,3E)-3-[1,3-dimethyl-3-(naphthalen-2-ylmethyl)indol-2-ylidene]prop-1-enyl]-3,3-dimethyl-1-propylindol-1-ium (PubChem CID 59307304) has the molecular formula C37H39N2+ and a molecular weight of 511.73 g/mol. Its IUPAC name is 2-[(E,3E)-3-[1,3-dimethyl-3-(naphthalen-2-ylmethyl)indol-2-ylidene]prop-1-enyl]-3,3-dimethyl-1-propylindol-1-ium.
| Compound Name | 2-[(E,3E)-3-[1,3-dimethyl-3-(naphthalen-2-ylmethyl)indol-2-ylidene]prop-1-enyl]-3,3-dimethyl-1-propylindol-1-ium |
|---|---|
| PubChem CID | 59307304 |
| Molecular Formula | C37H39N2+ |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 2-[(E,3E)-3-[1,3-dimethyl-3-(naphthalen-2-ylmethyl)indol-2-ylidene]prop-1-enyl]-3,3-dimethyl-1-propylindol-1-ium |
| SMILES | CCC[N+]1=C(/C=C/C=C2/N(C)c3ccccc3C2(C)Cc2ccc3ccccc3c2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C37H39N2/c1-6-24-39-33-19-12-9-16-30(33)36(2,3)34(39)20-13-21-35-37(4,31-17-10-11-18-32(31)38(35)5)26-27-22-23-28-14-7-8-15-29(28)25-27/h7-23,25H,6,24,26H2,1-5H3/q+1 |
| InChIKey | FXCIEBDCHVWERQ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|