C21H19NO — CID 146162623
(3R)-1,3-dimethyl-3-(naphthalen-2-ylmethyl)indol-2-one (PubChem CID 146162623) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is (3R)-1,3-dimethyl-3-(naphthalen-2-ylmethyl)indol-2-one.
| Compound Name | (3R)-1,3-dimethyl-3-(naphthalen-2-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 146162623 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (3R)-1,3-dimethyl-3-(naphthalen-2-ylmethyl)indol-2-one |
| SMILES | CN1C(=O)[C@](C)(Cc2ccc3ccccc3c2)c2ccccc21 |
| InChI | InChI=1S/C21H19NO/c1-21(18-9-5-6-10-19(18)22(2)20(21)23)14-15-11-12-16-7-3-4-8-17(16)13-15/h3-13H,14H2,1-2H3/t21-/m1/s1 |
| InChIKey | LVBPQIDJLXCOIW-OAQYLSRUSA-N |
| XLogP | 4.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |