C12H13Cl2NO — CID 102335587
(3R)-3-(2,2-dichloroethyl)-1,3-dimethylindol-2-one (PubChem CID 102335587) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is (3R)-3-(2,2-dichloroethyl)-1,3-dimethylindol-2-one.
| Compound Name | (3R)-3-(2,2-dichloroethyl)-1,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 102335587 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (3R)-3-(2,2-dichloroethyl)-1,3-dimethylindol-2-one |
| SMILES | CN1C(=O)[C@](C)(CC(Cl)Cl)c2ccccc21 |
| InChI | InChI=1S/C12H13Cl2NO/c1-12(7-10(13)14)8-5-3-4-6-9(8)15(2)11(12)16/h3-6,10H,7H2,1-2H3/t12-/m1/s1 |
| InChIKey | YEFBSEKVZUDYQX-GFCCVEGCSA-N |
| XLogP | 3.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|