C17H23NO — CID 102226125
3-(cyclohexylmethyl)-1,3-dimethylindol-2-one (PubChem CID 102226125) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-1,3-dimethylindol-2-one.
| Compound Name | 3-(cyclohexylmethyl)-1,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 102226125 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 3-(cyclohexylmethyl)-1,3-dimethylindol-2-one |
| SMILES | CN1C(=O)C(C)(CC2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C17H23NO/c1-17(12-13-8-4-3-5-9-13)14-10-6-7-11-15(14)18(2)16(17)19/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3 |
| InChIKey | ODBRRRPZWVMYBS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |