C15H21NO3 — CID 175686972
3-(2,3-dimethoxypropyl)-1,3-dimethylindol-2-one (PubChem CID 175686972) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-(2,3-dimethoxypropyl)-1,3-dimethylindol-2-one.
| Compound Name | 3-(2,3-dimethoxypropyl)-1,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 175686972 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-(2,3-dimethoxypropyl)-1,3-dimethylindol-2-one |
| SMILES | COCC(CC1(C)C(=O)N(C)c2ccccc21)OC |
| InChI | InChI=1S/C15H21NO3/c1-15(9-11(19-4)10-18-3)12-7-5-6-8-13(12)16(2)14(15)17/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | PRVNPFZPPJAVMX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |