C17H17NOSe — CID 164682274
(3S)-1,3-dimethyl-3-(phenylselanylmethyl)indol-2-one (PubChem CID 164682274) has the molecular formula C17H17NOSe and a molecular weight of 330.29 g/mol. Its IUPAC name is (3S)-1,3-dimethyl-3-(phenylselanylmethyl)indol-2-one.
| Compound Name | (3S)-1,3-dimethyl-3-(phenylselanylmethyl)indol-2-one |
|---|---|
| PubChem CID | 164682274 |
| Molecular Formula | C17H17NOSe |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (3S)-1,3-dimethyl-3-(phenylselanylmethyl)indol-2-one |
| SMILES | CN1C(=O)[C@@](C)(C[Se]c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H17NOSe/c1-17(12-20-13-8-4-3-5-9-13)14-10-6-7-11-15(14)18(2)16(17)19/h3-11H,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | OHHNSRLUIFYEDA-KRWDZBQOSA-N |
| XLogP | 2.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|