C14H19NO2 — CID 102528889
3-(2-hydroxybutyl)-1,3-dimethylindol-2-one (PubChem CID 102528889) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-(2-hydroxybutyl)-1,3-dimethylindol-2-one.
| Compound Name | 3-(2-hydroxybutyl)-1,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 102528889 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-(2-hydroxybutyl)-1,3-dimethylindol-2-one |
| SMILES | CCC(O)CC1(C)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C14H19NO2/c1-4-10(16)9-14(2)11-7-5-6-8-12(11)15(3)13(14)17/h5-8,10,16H,4,9H2,1-3H3 |
| InChIKey | QFVLOYOOVWDIAM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |