About 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione
1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione (PubChem CID 175687035) has the molecular formula C19H25NO3
and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione.
Molecular Properties
| Compound Name | 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione |
| PubChem CID | 175687035 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione |
| SMILES | CCC(=O)CCCCC(=O)CC1(C)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C19H25NO3/c1-4-14(21)9-5-6-10-15(22)13-19(2)16-11-7-8-12-17(16)20(3)18(19)23/h7-8,11-12H,4-6,9-10,13H2,1-3H3 |
| InChIKey | JHNPHRGNIJCFSX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione?
The IUPAC name of 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione (CID 175687035) is 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione.
What is the SMILES notation for 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione?
The canonical SMILES for 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione is CCC(=O)CCCCC(=O)CC1(C)C(=O)N(C)c2ccccc21.
What is the InChIKey of 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione?
The InChIKey is JHNPHRGNIJCFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO3/c1-4-14(21)9-5-6-10-15(22)13-19(2)16-11-7-8-12-17(16)20(3)18(19)23/h7-8,11-12H,4-6,9-10,13H2,1-3H3.
What are the key properties of 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione?
1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione has a molecular weight of 315.41 g/mol, XLogP of 3.42, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione is sourced from PubChem (CID 175687035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).