C19H25NO3 — CID 175687035
1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione (PubChem CID 175687035) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione.
| Compound Name | 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione |
|---|---|
| PubChem CID | 175687035 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-(1,3-dimethyl-2-oxoindol-3-yl)nonane-2,7-dione |
| SMILES | CCC(=O)CCCCC(=O)CC1(C)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C19H25NO3/c1-4-14(21)9-5-6-10-15(22)13-19(2)16-11-7-8-12-17(16)20(3)18(19)23/h7-8,11-12H,4-6,9-10,13H2,1-3H3 |
| InChIKey | JHNPHRGNIJCFSX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|